C10H19NO8 — CID 174435504
azane;2-ethoxy-3-hydroxypentane-1,2,3-tricarboxylic acid (PubChem CID 174435504) has the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. Its IUPAC name is azane;2-ethoxy-3-hydroxypentane-1,2,3-tricarboxylic acid.
| Compound Name | azane;2-ethoxy-3-hydroxypentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 174435504 |
| Molecular Formula | C10H19NO8 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | azane;2-ethoxy-3-hydroxypentane-1,2,3-tricarboxylic acid |
| SMILES | CCOC(CC(=O)O)(C(=O)O)C(O)(CC)C(=O)O.N |
| InChI | InChI=1S/C10H16O8.H3N/c1-3-9(17,7(13)14)10(8(15)16,18-4-2)5-6(11)12;/h17H,3-5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16);1H3 |
| InChIKey | KFDGFNLYNZZAJH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |