C32H54O15 — CID 87355375
2-(3-acetyloxycarbonylpentan-3-yl)-2-ethoxybutanedioic acid;2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid (PubChem CID 87355375) has the molecular formula C32H54O15 and a molecular weight of 678.77 g/mol. Its IUPAC name is 2-(3-acetyloxycarbonylpentan-3-yl)-2-ethoxybutanedioic acid;2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(3-acetyloxycarbonylpentan-3-yl)-2-ethoxybutanedioic acid;2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87355375 |
| Molecular Formula | C32H54O15 |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | 2-(3-acetyloxycarbonylpentan-3-yl)-2-ethoxybutanedioic acid;2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid |
| SMILES | CCCCOC(CC(=O)O)(C(=O)O)C(CCCC)(CCCC)C(=O)O.CCOC(CC(=O)O)(C(=O)O)C(CC)(CC)C(=O)OC(C)=O |
| InChI | InChI=1S/C18H32O7.C14H22O8/c1-4-7-10-17(15(21)22,11-8-5-2)18(16(23)24,13-14(19)20)25-12-9-6-3;1-5-13(6-2,12(20)22-9(4)15)14(11(18)19,21-7-3)8-10(16)17/h4-13H2,1-3H3,(H,19,20)(H,21,22)(H,23,24);5-8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | ZDPAXJBLWAMHPC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 248.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|