C20H34O8 — CID 54205180
4-acetyl-2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid (PubChem CID 54205180) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-acetyl-2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid.
| Compound Name | 4-acetyl-2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 54205180 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-acetyl-2-butoxy-3-butylheptane-1,2,3-tricarboxylic acid |
| SMILES | CCCCOC(CC(=O)O)(C(=O)O)C(CCCC)(C(=O)O)C(CCC)C(C)=O |
| InChI | InChI=1S/C20H34O8/c1-5-8-11-19(17(24)25,15(10-7-3)14(4)21)20(18(26)27,13-16(22)23)28-12-9-6-2/h15H,5-13H2,1-4H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | PRZWVWNAPCOHOO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|