C14H16O11 — CID 87704431
2-acetyloxy-2-(3-acetyloxycarbonyl-2,4-dioxopentan-3-yl)butanedioic acid (PubChem CID 87704431) has the molecular formula C14H16O11 and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-acetyloxy-2-(3-acetyloxycarbonyl-2,4-dioxopentan-3-yl)butanedioic acid.
| Compound Name | 2-acetyloxy-2-(3-acetyloxycarbonyl-2,4-dioxopentan-3-yl)butanedioic acid |
|---|---|
| PubChem CID | 87704431 |
| Molecular Formula | C14H16O11 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-acetyloxy-2-(3-acetyloxycarbonyl-2,4-dioxopentan-3-yl)butanedioic acid |
| SMILES | CC(=O)OC(=O)C(C(C)=O)(C(C)=O)C(CC(=O)O)(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H16O11/c1-6(15)14(7(2)16,12(23)24-8(3)17)13(11(21)22,5-10(19)20)25-9(4)18/h5H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | YYACUYFTKZUGIQ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|