C12H22O5 — CID 87791388
2-tert-butyl-2-[(2-methylpropan-2-yl)oxy]butanedioic acid (PubChem CID 87791388) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-tert-butyl-2-[(2-methylpropan-2-yl)oxy]butanedioic acid.
| Compound Name | 2-tert-butyl-2-[(2-methylpropan-2-yl)oxy]butanedioic acid |
|---|---|
| PubChem CID | 87791388 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-tert-butyl-2-[(2-methylpropan-2-yl)oxy]butanedioic acid |
| SMILES | CC(C)(C)OC(CC(=O)O)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H22O5/c1-10(2,3)12(9(15)16,7-8(13)14)17-11(4,5)6/h7H2,1-6H3,(H,13,14)(H,15,16) |
| InChIKey | JKZKLCAKSZKQBA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |