2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid

C12H20O7 — CID 18458326

IUPAC2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid
SMILESCCOC(CC(=O)O)(C(=O)O)C(CC)(CC)C(=O)O
InChIInChI=1S/C12H20O7/c1-4-11(5-2,9(15)16)12(10(17)18,19-6-3)7-8(13)14/h4-7H2,1-3H3,(H,13,14)(H,15,16)(H,17,18)
InChIKeyDYPZOMGXSGKWPS-UHFFFAOYSA-N
MW276.28 g/mol
LogP1.21
Rot. Bonds9

About 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid

2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid (PubChem CID 18458326) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Name2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid
PubChem CID18458326
Molecular FormulaC12H20O7
Molecular Weight276.28 g/mol
Exact Mass276.12
IUPAC Name2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid
SMILESCCOC(CC(=O)O)(C(=O)O)C(CC)(CC)C(=O)O
InChIInChI=1S/C12H20O7/c1-4-11(5-2,9(15)16)12(10(17)18,19-6-3)7-8(13)14/h4-7H2,1-3H3,(H,13,14)(H,15,16)(H,17,18)
InChIKeyDYPZOMGXSGKWPS-UHFFFAOYSA-N
XLogP1.21
TPSA121.13 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.28
LogP ≤ 51.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid?
The IUPAC name of 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid (CID 18458326) is 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid.
What is the SMILES notation for 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid?
The canonical SMILES for 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid is CCOC(CC(=O)O)(C(=O)O)C(CC)(CC)C(=O)O.
What is the InChIKey of 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid?
The InChIKey is DYPZOMGXSGKWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O7/c1-4-11(5-2,9(15)16)12(10(17)18,19-6-3)7-8(13)14/h4-7H2,1-3H3,(H,13,14)(H,15,16)(H,17,18).
What are the key properties of 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid?
2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid has a molecular weight of 276.28 g/mol, XLogP of 1.21, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 18458326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).