C12H20O7 — CID 18458326
2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid (PubChem CID 18458326) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid.
| Compound Name | 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 18458326 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-ethoxy-3-ethylpentane-1,2,3-tricarboxylic acid |
| SMILES | CCOC(CC(=O)O)(C(=O)O)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C12H20O7/c1-4-11(5-2,9(15)16)12(10(17)18,19-6-3)7-8(13)14/h4-7H2,1-3H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | DYPZOMGXSGKWPS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |