C12H22O4 — CID 23424098
2,2,3,3-tetraethylbutanedioic acid (PubChem CID 23424098) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2,2,3,3-tetraethylbutanedioic acid.
| Compound Name | 2,2,3,3-tetraethylbutanedioic acid |
|---|---|
| PubChem CID | 23424098 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,2,3,3-tetraethylbutanedioic acid |
| SMILES | CCC(CC)(C(=O)O)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C12H22O4/c1-5-11(6-2,9(13)14)12(7-3,8-4)10(15)16/h5-8H2,1-4H3,(H,13,14)(H,15,16) |
| InChIKey | CQCFISPMNREOQX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |