C13H26O2 — CID 123370825
2-tert-butyl-2-ethyl-4,4-dimethylpentanoic acid (PubChem CID 123370825) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-tert-butyl-2-ethyl-4,4-dimethylpentanoic acid.
| Compound Name | 2-tert-butyl-2-ethyl-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 123370825 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-tert-butyl-2-ethyl-4,4-dimethylpentanoic acid |
| SMILES | CCC(CC(C)(C)C)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-8-13(10(14)15,12(5,6)7)9-11(2,3)4/h8-9H2,1-7H3,(H,14,15) |
| InChIKey | GCZAYFZHMSQOQF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |