About 3,3-diethyl-4,4-dimethylpentan-2-one;ethane
3,3-diethyl-4,4-dimethylpentan-2-one;ethane (PubChem CID 142252280) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is 3,3-diethyl-4,4-dimethylpentan-2-one;ethane.
Molecular Properties
| Compound Name | 3,3-diethyl-4,4-dimethylpentan-2-one;ethane |
| PubChem CID | 142252280 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 3,3-diethyl-4,4-dimethylpentan-2-one;ethane |
| SMILES | CC.CCC(CC)(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O.C2H6/c1-7-11(8-2,9(3)12)10(4,5)6;1-2/h7-8H2,1-6H3;1-2H3 |
| InChIKey | QFTKXABPHAGEDP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethyl-4,4-dimethylpentan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-4,4-dimethylpentan-2-one;ethane?
The IUPAC name of 3,3-diethyl-4,4-dimethylpentan-2-one;ethane (CID 142252280) is 3,3-diethyl-4,4-dimethylpentan-2-one;ethane.
What is the SMILES notation for 3,3-diethyl-4,4-dimethylpentan-2-one;ethane?
The canonical SMILES for 3,3-diethyl-4,4-dimethylpentan-2-one;ethane is CC.CCC(CC)(C(C)=O)C(C)(C)C.
What is the InChIKey of 3,3-diethyl-4,4-dimethylpentan-2-one;ethane?
The InChIKey is QFTKXABPHAGEDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C2H6/c1-7-11(8-2,9(3)12)10(4,5)6;1-2/h7-8H2,1-6H3;1-2H3.
What are the key properties of 3,3-diethyl-4,4-dimethylpentan-2-one;ethane?
3,3-diethyl-4,4-dimethylpentan-2-one;ethane has a molecular weight of 200.37 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-4,4-dimethylpentan-2-one;ethane is sourced from PubChem (CID 142252280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).