C10H15F3O2 — CID 158196013
5-ethyl-5-(trifluoromethyl)heptane-2,4-dione (PubChem CID 158196013) has the molecular formula C10H15F3O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-ethyl-5-(trifluoromethyl)heptane-2,4-dione.
| Compound Name | 5-ethyl-5-(trifluoromethyl)heptane-2,4-dione |
|---|---|
| PubChem CID | 158196013 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-ethyl-5-(trifluoromethyl)heptane-2,4-dione |
| SMILES | CCC(CC)(C(=O)CC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2/c1-4-9(5-2,10(11,12)13)8(15)6-7(3)14/h4-6H2,1-3H3 |
| InChIKey | NTGCROWKDJRFPR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|