pentane-2,4-dione;2,2,2-trifluoroacetic acid

C7H9F3O4 — CID 161201748

IUPACpentane-2,4-dione;2,2,2-trifluoroacetic acid
SMILESCC(=O)CC(C)=O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H8O2.C2HF3O2/c1-4(6)3-5(2)7;3-2(4,5)1(6)7/h3H2,1-2H3;(H,6,7)
InChIKeyUVBLQRNCZIPBBT-UHFFFAOYSA-N
MW214.14 g/mol
LogP1.19
Rot. Bonds2

About pentane-2,4-dione;2,2,2-trifluoroacetic acid

pentane-2,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 161201748) has the molecular formula C7H9F3O4 and a molecular weight of 214.14 g/mol. Its IUPAC name is pentane-2,4-dione;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namepentane-2,4-dione;2,2,2-trifluoroacetic acid
PubChem CID161201748
Molecular FormulaC7H9F3O4
Molecular Weight214.14 g/mol
Exact Mass214.05
IUPAC Namepentane-2,4-dione;2,2,2-trifluoroacetic acid
SMILESCC(=O)CC(C)=O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H8O2.C2HF3O2/c1-4(6)3-5(2)7;3-2(4,5)1(6)7/h3H2,1-2H3;(H,6,7)
InChIKeyUVBLQRNCZIPBBT-UHFFFAOYSA-N
XLogP1.19
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.14
LogP ≤ 51.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze pentane-2,4-dione;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentane-2,4-dione;2,2,2-trifluoroacetic acid?
The IUPAC name of pentane-2,4-dione;2,2,2-trifluoroacetic acid (CID 161201748) is pentane-2,4-dione;2,2,2-trifluoroacetic acid.
What is the SMILES notation for pentane-2,4-dione;2,2,2-trifluoroacetic acid?
The canonical SMILES for pentane-2,4-dione;2,2,2-trifluoroacetic acid is CC(=O)CC(C)=O.O=C(O)C(F)(F)F.
What is the InChIKey of pentane-2,4-dione;2,2,2-trifluoroacetic acid?
The InChIKey is UVBLQRNCZIPBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C2HF3O2/c1-4(6)3-5(2)7;3-2(4,5)1(6)7/h3H2,1-2H3;(H,6,7).
What are the key properties of pentane-2,4-dione;2,2,2-trifluoroacetic acid?
pentane-2,4-dione;2,2,2-trifluoroacetic acid has a molecular weight of 214.14 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 161201748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).