C5H5F3O2Sm — CID 174544017
samarium;1,1,1-trifluoropentane-2,4-dione (PubChem CID 174544017) has the molecular formula C5H5F3O2Sm and a molecular weight of 304.45 g/mol. Its IUPAC name is samarium;1,1,1-trifluoropentane-2,4-dione.
| Compound Name | samarium;1,1,1-trifluoropentane-2,4-dione |
|---|---|
| PubChem CID | 174544017 |
| Molecular Formula | C5H5F3O2Sm |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | samarium;1,1,1-trifluoropentane-2,4-dione |
| SMILES | CC(=O)CC(=O)C(F)(F)F.[Sm] |
| InChI | InChI=1S/C5H5F3O2.Sm/c1-3(9)2-4(10)5(6,7)8;/h2H2,1H3; |
| InChIKey | KKGPBQKALXSSJM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|