C7H9EuF3O2 — CID 159104336
europium;1,1,1-trifluoroheptane-2,4-dione (PubChem CID 159104336) has the molecular formula C7H9EuF3O2 and a molecular weight of 334.11 g/mol. Its IUPAC name is europium;1,1,1-trifluoroheptane-2,4-dione.
| Compound Name | europium;1,1,1-trifluoroheptane-2,4-dione |
|---|---|
| PubChem CID | 159104336 |
| Molecular Formula | C7H9EuF3O2 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | europium;1,1,1-trifluoroheptane-2,4-dione |
| SMILES | CCCC(=O)CC(=O)C(F)(F)F.[Eu] |
| InChI | InChI=1S/C7H9F3O2.Eu/c1-2-3-5(11)4-6(12)7(8,9)10;/h2-4H2,1H3; |
| InChIKey | KDRMZQMWTIBJCQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|