C11H17F3O2 — CID 175186134
11,11,11-trifluoroundecane-4,6-dione (PubChem CID 175186134) has the molecular formula C11H17F3O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 11,11,11-trifluoroundecane-4,6-dione.
| Compound Name | 11,11,11-trifluoroundecane-4,6-dione |
|---|---|
| PubChem CID | 175186134 |
| Molecular Formula | C11H17F3O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 11,11,11-trifluoroundecane-4,6-dione |
| SMILES | CCCC(=O)CC(=O)CCCCC(F)(F)F |
| InChI | InChI=1S/C11H17F3O2/c1-2-5-9(15)8-10(16)6-3-4-7-11(12,13)14/h2-8H2,1H3 |
| InChIKey | FBQIGQFRDATYJC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|