C10H11F7O2 — CID 140781618
1,1,1-trifluoro-2-(fluoromethyl)-2-(trifluoromethyl)octane-3,5-dione (PubChem CID 140781618) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(fluoromethyl)-2-(trifluoromethyl)octane-3,5-dione.
| Compound Name | 1,1,1-trifluoro-2-(fluoromethyl)-2-(trifluoromethyl)octane-3,5-dione |
|---|---|
| PubChem CID | 140781618 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1,1,1-trifluoro-2-(fluoromethyl)-2-(trifluoromethyl)octane-3,5-dione |
| SMILES | CCCC(=O)CC(=O)C(CF)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O2/c1-2-3-6(18)4-7(19)8(5-11,9(12,13)14)10(15,16)17/h2-5H2,1H3 |
| InChIKey | KVQZWFFFCPLMDX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|