C5H6F3LiO2 — CID 173192040
lithium;hydride;1,1,1-trifluoropentane-2,4-dione (PubChem CID 173192040) has the molecular formula C5H6F3LiO2 and a molecular weight of 162.04 g/mol. Its IUPAC name is lithium;hydride;1,1,1-trifluoropentane-2,4-dione.
| Compound Name | lithium;hydride;1,1,1-trifluoropentane-2,4-dione |
|---|---|
| PubChem CID | 173192040 |
| Molecular Formula | C5H6F3LiO2 |
| Molecular Weight | 162.04 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | lithium;hydride;1,1,1-trifluoropentane-2,4-dione |
| SMILES | CC(=O)CC(=O)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C5H5F3O2.Li.H/c1-3(9)2-4(10)5(6,7)8;;/h2H2,1H3;;/q;+1;-1 |
| InChIKey | ZJBXVQKLHAMXDH-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.04 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|