C11H20O3Zr — CID 174907853
5,5-dimethylhexane-2,4-dione;propan-2-one;zirconium (PubChem CID 174907853) has the molecular formula C11H20O3Zr and a molecular weight of 291.50 g/mol. Its IUPAC name is 5,5-dimethylhexane-2,4-dione;propan-2-one;zirconium.
| Compound Name | 5,5-dimethylhexane-2,4-dione;propan-2-one;zirconium |
|---|---|
| PubChem CID | 174907853 |
| Molecular Formula | C11H20O3Zr |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5,5-dimethylhexane-2,4-dione;propan-2-one;zirconium |
| SMILES | CC(=O)CC(=O)C(C)(C)C.CC(C)=O.[Zr] |
| InChI | InChI=1S/C8H14O2.C3H6O.Zr/c1-6(9)5-7(10)8(2,3)4;1-3(2)4;/h5H2,1-4H3;1-2H3; |
| InChIKey | XUIYNTIRWVXBIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|