C24H42O6 — CID 158903230
6,6-dimethylheptane-2,5-dione;5,5-dimethylhexane-2,4-dione;4,4-dimethylpentane-2,3-dione (PubChem CID 158903230) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is 6,6-dimethylheptane-2,5-dione;5,5-dimethylhexane-2,4-dione;4,4-dimethylpentane-2,3-dione.
| Compound Name | 6,6-dimethylheptane-2,5-dione;5,5-dimethylhexane-2,4-dione;4,4-dimethylpentane-2,3-dione |
|---|---|
| PubChem CID | 158903230 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 6,6-dimethylheptane-2,5-dione;5,5-dimethylhexane-2,4-dione;4,4-dimethylpentane-2,3-dione |
| SMILES | CC(=O)C(=O)C(C)(C)C.CC(=O)CC(=O)C(C)(C)C.CC(=O)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H16O2.C8H14O2.C7H12O2/c1-7(10)5-6-8(11)9(2,3)4;1-6(9)5-7(10)8(2,3)4;1-5(8)6(9)7(2,3)4/h5-6H2,1-4H3;5H2,1-4H3;1-4H3 |
| InChIKey | JFSCXZKHUKSJAS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|