C22H40O5V — CID 88830247
oxovanadium;bis(2,2,6,6-tetramethylheptane-3,5-dione) (PubChem CID 88830247) has the molecular formula C22H40O5V and a molecular weight of 435.50 g/mol. Its IUPAC name is oxovanadium;bis(2,2,6,6-tetramethylheptane-3,5-dione).
| Compound Name | oxovanadium;bis(2,2,6,6-tetramethylheptane-3,5-dione) |
|---|---|
| PubChem CID | 88830247 |
| Molecular Formula | C22H40O5V |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | oxovanadium;bis(2,2,6,6-tetramethylheptane-3,5-dione) |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C.CC(C)(C)C(=O)CC(=O)C(C)(C)C.O=[V] |
| InChI | InChI=1S/2C11H20O2.O.V/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;;/h2*7H2,1-6H3;; |
| InChIKey | VABVKDIMAZGLLZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|