C11H19O4Rb — CID 173289199
hydride;rubidium(1+);2,2,6,6-tetramethyl-3,5-dioxoheptanoic acid (PubChem CID 173289199) has the molecular formula C11H19O4Rb and a molecular weight of 300.74 g/mol. Its IUPAC name is hydride;rubidium(1+);2,2,6,6-tetramethyl-3,5-dioxoheptanoic acid.
| Compound Name | hydride;rubidium(1+);2,2,6,6-tetramethyl-3,5-dioxoheptanoic acid |
|---|---|
| PubChem CID | 173289199 |
| Molecular Formula | C11H19O4Rb |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | hydride;rubidium(1+);2,2,6,6-tetramethyl-3,5-dioxoheptanoic acid |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C(=O)O.[H-].[Rb+] |
| InChI | InChI=1S/C11H18O4.Rb.H/c1-10(2,3)7(12)6-8(13)11(4,5)9(14)15;;/h6H2,1-5H3,(H,14,15);;/q;+1;-1 |
| InChIKey | OSSOIGSAYDSTEC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|