C11H20O2Pr — CID 139531007
praseodymium;2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 139531007) has the molecular formula C11H20O2Pr and a molecular weight of 325.19 g/mol. Its IUPAC name is praseodymium;2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | praseodymium;2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 139531007 |
| Molecular Formula | C11H20O2Pr |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | praseodymium;2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C.[Pr] |
| InChI | InChI=1S/C11H20O2.Pr/c1-10(2,3)8(12)7-9(13)11(4,5)6;/h7H2,1-6H3; |
| InChIKey | BTHKKGNFNRSFSR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|