C20H36O4 — CID 158377465
3-tert-butylpentane-2,4-dione;2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 158377465) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 3-tert-butylpentane-2,4-dione;2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | 3-tert-butylpentane-2,4-dione;2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 158377465 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 3-tert-butylpentane-2,4-dione;2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(=O)C(C(C)=O)C(C)(C)C.CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O2.C9H16O2/c1-10(2,3)8(12)7-9(13)11(4,5)6;1-6(10)8(7(2)11)9(3,4)5/h7H2,1-6H3;8H,1-5H3 |
| InChIKey | GVJMXNUNXLMNJZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|