C11H20CaO2+2 — CID 21192278
calcium 2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 21192278) has the molecular formula C11H20CaO2+2 and a molecular weight of 224.36 g/mol. Its IUPAC name is calcium 2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | calcium 2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 21192278 |
| Molecular Formula | C11H20CaO2+2 |
| Molecular Weight | 224.36 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | calcium 2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C.[Ca+2] |
| InChI | InChI=1S/C11H20O2.Ca/c1-10(2,3)8(12)7-9(13)11(4,5)6;/h7H2,1-6H3;/q;+2 |
| InChIKey | XGWJBHKBWRNYGO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|