C22H38O4Zr — CID 175034885
bis(2-methanidyl-2,6,6-trimethylheptane-3,5-dione);zirconium(2+) (PubChem CID 175034885) has the molecular formula C22H38O4Zr and a molecular weight of 457.77 g/mol. Its IUPAC name is bis(2-methanidyl-2,6,6-trimethylheptane-3,5-dione);zirconium(2+).
| Compound Name | bis(2-methanidyl-2,6,6-trimethylheptane-3,5-dione);zirconium(2+) |
|---|---|
| PubChem CID | 175034885 |
| Molecular Formula | C22H38O4Zr |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | bis(2-methanidyl-2,6,6-trimethylheptane-3,5-dione);zirconium(2+) |
| SMILES | [CH2-]C(C)(C)C(=O)CC(=O)C(C)(C)C.[CH2-]C(C)(C)C(=O)CC(=O)C(C)(C)C.[Zr+2] |
| InChI | InChI=1S/2C11H19O2.Zr/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*1,7H2,2-6H3;/q2*-1;+2 |
| InChIKey | CNZFIQNXHBLPHC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|