C16H26O4Zn — CID 134608015
zinc bis(5,5-dimethylhexane-2,4-dione) (PubChem CID 134608015) has the molecular formula C16H26O4Zn and a molecular weight of 347.77 g/mol. Its IUPAC name is zinc bis(5,5-dimethylhexane-2,4-dione).
| Compound Name | zinc bis(5,5-dimethylhexane-2,4-dione) |
|---|---|
| PubChem CID | 134608015 |
| Molecular Formula | C16H26O4Zn |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | zinc bis(5,5-dimethylhexane-2,4-dione) |
| SMILES | [CH2-]C(=O)CC(=O)C(C)(C)C.[CH2-]C(=O)CC(=O)C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C8H13O2.Zn/c2*1-6(9)5-7(10)8(2,3)4;/h2*1,5H2,2-4H3;/q2*-1;+2 |
| InChIKey | GEPRKEAEILLFPX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|