2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid

C10H21O5P — CID 173238819

IUPAC2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid
SMILESCCC(CC)(C(=O)O)C(C)(C)CP(=O)(O)O
InChIInChI=1S/C10H21O5P/c1-5-10(6-2,8(11)12)9(3,4)7-16(13,14)15/h5-7H2,1-4H3,(H,11,12)(H2,13,14,15)
InChIKeyYVMIAXRVIPPJCZ-UHFFFAOYSA-N
MW252.25 g/mol
LogP2.08
Rot. Bonds6

About 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid

2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid (PubChem CID 173238819) has the molecular formula C10H21O5P and a molecular weight of 252.25 g/mol. Its IUPAC name is 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid.

Molecular Properties

Compound Name2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid
PubChem CID173238819
Molecular FormulaC10H21O5P
Molecular Weight252.25 g/mol
Exact Mass252.11
IUPAC Name2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid
SMILESCCC(CC)(C(=O)O)C(C)(C)CP(=O)(O)O
InChIInChI=1S/C10H21O5P/c1-5-10(6-2,8(11)12)9(3,4)7-16(13,14)15/h5-7H2,1-4H3,(H,11,12)(H2,13,14,15)
InChIKeyYVMIAXRVIPPJCZ-UHFFFAOYSA-N
XLogP2.08
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.25
LogP ≤ 52.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid?
The IUPAC name of 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid (CID 173238819) is 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid.
What is the SMILES notation for 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid?
The canonical SMILES for 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid is CCC(CC)(C(=O)O)C(C)(C)CP(=O)(O)O.
What is the InChIKey of 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid?
The InChIKey is YVMIAXRVIPPJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O5P/c1-5-10(6-2,8(11)12)9(3,4)7-16(13,14)15/h5-7H2,1-4H3,(H,11,12)(H2,13,14,15).
What are the key properties of 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid?
2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid has a molecular weight of 252.25 g/mol, XLogP of 2.08, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-3,3-dimethyl-4-phosphonobutanoic acid is sourced from PubChem (CID 173238819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).