C17H20O10 — CID 173141057
4-O-(4-acetyl-3-acetyloxycarbonyl-2,5-dioxohexan-3-yl) 1-O-ethyl but-2-enedioate (PubChem CID 173141057) has the molecular formula C17H20O10 and a molecular weight of 384.34 g/mol. Its IUPAC name is 4-O-(4-acetyl-3-acetyloxycarbonyl-2,5-dioxohexan-3-yl) 1-O-ethyl but-2-enedioate.
| Compound Name | 4-O-(4-acetyl-3-acetyloxycarbonyl-2,5-dioxohexan-3-yl) 1-O-ethyl but-2-enedioate |
|---|---|
| PubChem CID | 173141057 |
| Molecular Formula | C17H20O10 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-O-(4-acetyl-3-acetyloxycarbonyl-2,5-dioxohexan-3-yl) 1-O-ethyl but-2-enedioate |
| SMILES | CCOC(=O)C=CC(=O)OC(C(C)=O)(C(=O)OC(C)=O)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C17H20O10/c1-6-25-13(22)7-8-14(23)27-17(11(4)20,16(24)26-12(5)21)15(9(2)18)10(3)19/h7-8,15H,6H2,1-5H3 |
| InChIKey | OAAJWIYJDXXLCA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|