About (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc
(E)-4-ethoxy-4-oxobut-2-enoic acid;zinc (PubChem CID 6450328) has the molecular formula C6H8O4Zn
and a molecular weight of 209.52 g/mol. Its IUPAC name is (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc.
Molecular Properties
| Compound Name | (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc |
| PubChem CID | 6450328 |
| Molecular Formula | C6H8O4Zn |
| Molecular Weight | 209.52 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc |
| SMILES | CCOC(=O)/C=C/C(=O)O.[Zn] |
| InChI | InChI=1S/C6H8O4.Zn/c1-2-10-6(9)4-3-5(7)8;/h3-4H,2H2,1H3,(H,7,8);/b4-3+; |
| InChIKey | MSROJJRDHUUOCL-BJILWQEISA-N |
| XLogP | 0.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc?
The IUPAC name of (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc (CID 6450328) is (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc.
What is the SMILES notation for (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc?
The canonical SMILES for (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc is CCOC(=O)/C=C/C(=O)O.[Zn].
What is the InChIKey of (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc?
The InChIKey is MSROJJRDHUUOCL-BJILWQEISA-N. The full InChI is InChI=1S/C6H8O4.Zn/c1-2-10-6(9)4-3-5(7)8;/h3-4H,2H2,1H3,(H,7,8);/b4-3+;.
What are the key properties of (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc?
(E)-4-ethoxy-4-oxobut-2-enoic acid;zinc has a molecular weight of 209.52 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethoxy-4-oxobut-2-enoic acid;zinc is sourced from PubChem (CID 6450328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).