About (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol
(Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol (PubChem CID 87766277) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol.
Molecular Properties
| Compound Name | (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol |
| PubChem CID | 87766277 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol |
| SMILES | CCCCCCO.CCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H8O4.C6H14O/c1-2-10-6(9)4-3-5(7)8;1-2-3-4-5-6-7/h3-4H,2H2,1H3,(H,7,8);7H,2-6H2,1H3/b4-3-; |
| InChIKey | XYMLGVWQKBSUJD-LNKPDPKZSA-N |
| XLogP | 1.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol?
The IUPAC name of (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol (CID 87766277) is (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol.
What is the SMILES notation for (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol?
The canonical SMILES for (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol is CCCCCCO.CCOC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol?
The InChIKey is XYMLGVWQKBSUJD-LNKPDPKZSA-N. The full InChI is InChI=1S/C6H8O4.C6H14O/c1-2-10-6(9)4-3-5(7)8;1-2-3-4-5-6-7/h3-4H,2H2,1H3,(H,7,8);7H,2-6H2,1H3/b4-3-;.
What are the key properties of (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol?
(Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol has a molecular weight of 246.30 g/mol, XLogP of 1.75, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-ethoxy-4-oxobut-2-enoic acid;hexan-1-ol is sourced from PubChem (CID 87766277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).