C8H13NO6 — CID 5358901
2-aminoacetic acid;(E)-4-ethoxy-4-oxobut-2-enoic acid (PubChem CID 5358901) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-aminoacetic acid;(E)-4-ethoxy-4-oxobut-2-enoic acid.
| Compound Name | 2-aminoacetic acid;(E)-4-ethoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 5358901 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-aminoacetic acid;(E)-4-ethoxy-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)/C=C/C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C6H8O4.C2H5NO2/c1-2-10-6(9)4-3-5(7)8;3-1-2(4)5/h3-4H,2H2,1H3,(H,7,8);1,3H2,(H,4,5)/b4-3+; |
| InChIKey | OKAWOVPYUNPYAP-BJILWQEISA-N |
| XLogP | -0.78 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|