C12H13BrO8 — CID 173141154
4-O-(1-acetyloxy-3-bromo-2-methyl-1,3-dioxopropan-2-yl) 1-O-ethyl but-2-enedioate (PubChem CID 173141154) has the molecular formula C12H13BrO8 and a molecular weight of 365.13 g/mol. Its IUPAC name is 4-O-(1-acetyloxy-3-bromo-2-methyl-1,3-dioxopropan-2-yl) 1-O-ethyl but-2-enedioate.
| Compound Name | 4-O-(1-acetyloxy-3-bromo-2-methyl-1,3-dioxopropan-2-yl) 1-O-ethyl but-2-enedioate |
|---|---|
| PubChem CID | 173141154 |
| Molecular Formula | C12H13BrO8 |
| Molecular Weight | 365.13 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 4-O-(1-acetyloxy-3-bromo-2-methyl-1,3-dioxopropan-2-yl) 1-O-ethyl but-2-enedioate |
| SMILES | CCOC(=O)C=CC(=O)OC(C)(C(=O)Br)C(=O)OC(C)=O |
| InChI | InChI=1S/C12H13BrO8/c1-4-19-8(15)5-6-9(16)21-12(3,10(13)17)11(18)20-7(2)14/h5-6H,4H2,1-3H3 |
| InChIKey | NYOSYZRROCWHSG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|