C16H26O8 — CID 22395602
3-acetyloxycarbonyl-3-hydroxy-5-octoxy-5-oxopentanoic acid (PubChem CID 22395602) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-acetyloxycarbonyl-3-hydroxy-5-octoxy-5-oxopentanoic acid.
| Compound Name | 3-acetyloxycarbonyl-3-hydroxy-5-octoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22395602 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-acetyloxycarbonyl-3-hydroxy-5-octoxy-5-oxopentanoic acid |
| SMILES | CCCCCCCCOC(=O)CC(O)(CC(=O)O)C(=O)OC(C)=O |
| InChI | InChI=1S/C16H26O8/c1-3-4-5-6-7-8-9-23-14(20)11-16(22,10-13(18)19)15(21)24-12(2)17/h22H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | RWBSAYMFOGLWJW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|