C11H22O7 — CID 134329051
2,3-diethyl-2,3-dihydroxybutanedioic acid;propan-2-ol (PubChem CID 134329051) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2,3-diethyl-2,3-dihydroxybutanedioic acid;propan-2-ol.
| Compound Name | 2,3-diethyl-2,3-dihydroxybutanedioic acid;propan-2-ol |
|---|---|
| PubChem CID | 134329051 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2,3-diethyl-2,3-dihydroxybutanedioic acid;propan-2-ol |
| SMILES | CC(C)O.CCC(O)(C(=O)O)C(O)(CC)C(=O)O |
| InChI | InChI=1S/C8H14O6.C3H8O/c1-3-7(13,5(9)10)8(14,4-2)6(11)12;1-3(2)4/h13-14H,3-4H2,1-2H3,(H,9,10)(H,11,12);3-4H,1-2H3 |
| InChIKey | QUXNWUJABLJXAY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |