C7H11F3O3 — CID 139819668
(2S)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid (PubChem CID 139819668) has the molecular formula C7H11F3O3 and a molecular weight of 200.16 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid.
| Compound Name | (2S)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 139819668 |
| Molecular Formula | C7H11F3O3 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (2S)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid |
| SMILES | CC(C)C[C@](O)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O3/c1-4(2)3-6(13,5(11)12)7(8,9)10/h4,13H,3H2,1-2H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | XCCVDTCEBQGRLF-LURJTMIESA-N |
| XLogP | 1.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |