4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid

C9H15F3O3 — CID 157318706

IUPAC4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid
SMILESCC(C)CC(C(=O)O)C(C)(O)C(F)(F)F
InChIInChI=1S/C9H15F3O3/c1-5(2)4-6(7(13)14)8(3,15)9(10,11)12/h5-6,15H,4H2,1-3H3,(H,13,14)
InChIKeyNWECWBBSRXPPML-UHFFFAOYSA-N
MW228.21 g/mol
LogP2.05
Rot. Bonds4

About 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid

4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid (PubChem CID 157318706) has the molecular formula C9H15F3O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid.

Molecular Properties

Compound Name4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid
PubChem CID157318706
Molecular FormulaC9H15F3O3
Molecular Weight228.21 g/mol
Exact Mass228.10
IUPAC Name4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid
SMILESCC(C)CC(C(=O)O)C(C)(O)C(F)(F)F
InChIInChI=1S/C9H15F3O3/c1-5(2)4-6(7(13)14)8(3,15)9(10,11)12/h5-6,15H,4H2,1-3H3,(H,13,14)
InChIKeyNWECWBBSRXPPML-UHFFFAOYSA-N
XLogP2.05
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.21
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The IUPAC name of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid (CID 157318706) is 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid.
What is the SMILES notation for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The canonical SMILES for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid is CC(C)CC(C(=O)O)C(C)(O)C(F)(F)F.
What is the InChIKey of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The InChIKey is NWECWBBSRXPPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3/c1-5(2)4-6(7(13)14)8(3,15)9(10,11)12/h5-6,15H,4H2,1-3H3,(H,13,14).
What are the key properties of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid has a molecular weight of 228.21 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid is sourced from PubChem (CID 157318706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).