About 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid
4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid (PubChem CID 157318706) has the molecular formula C9H15F3O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid.
Analyze 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The IUPAC name of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid (CID 157318706) is 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid.
What is the SMILES notation for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The canonical SMILES for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid is CC(C)CC(C(=O)O)C(C)(O)C(F)(F)F.
What is the InChIKey of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
The InChIKey is NWECWBBSRXPPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3/c1-5(2)4-6(7(13)14)8(3,15)9(10,11)12/h5-6,15H,4H2,1-3H3,(H,13,14).
What are the key properties of 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid?
4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid has a molecular weight of 228.21 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)pentanoic acid is sourced from PubChem (CID 157318706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).