C8H13F3O2 — CID 129371887
(2R)-4-methyl-2-(2,2,2-trifluoroethyl)pentanoic acid (PubChem CID 129371887) has the molecular formula C8H13F3O2 and a molecular weight of 198.18 g/mol. Its IUPAC name is (2R)-4-methyl-2-(2,2,2-trifluoroethyl)pentanoic acid.
| Compound Name | (2R)-4-methyl-2-(2,2,2-trifluoroethyl)pentanoic acid |
|---|---|
| PubChem CID | 129371887 |
| Molecular Formula | C8H13F3O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2R)-4-methyl-2-(2,2,2-trifluoroethyl)pentanoic acid |
| SMILES | CC(C)C[C@H](CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H13F3O2/c1-5(2)3-6(7(12)13)4-8(9,10)11/h5-6H,3-4H2,1-2H3,(H,12,13)/t6-/m1/s1 |
| InChIKey | UHVKVVCRCCSRIB-ZCFIWIBFSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |