C19H38O — CID 174839184
2,8-dimethyl-4,6-bis(2-methylpropyl)nonan-5-one (PubChem CID 174839184) has the molecular formula C19H38O and a molecular weight of 282.51 g/mol. Its IUPAC name is 2,8-dimethyl-4,6-bis(2-methylpropyl)nonan-5-one.
| Compound Name | 2,8-dimethyl-4,6-bis(2-methylpropyl)nonan-5-one |
|---|---|
| PubChem CID | 174839184 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | 2,8-dimethyl-4,6-bis(2-methylpropyl)nonan-5-one |
| SMILES | CC(C)CC(CC(C)C)C(=O)C(CC(C)C)CC(C)C |
| InChI | InChI=1S/C19H38O/c1-13(2)9-17(10-14(3)4)19(20)18(11-15(5)6)12-16(7)8/h13-18H,9-12H2,1-8H3 |
| InChIKey | LRUDOCGHAAYXEY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |