2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid

C14H29NO2 — CID 122128173

IUPAC2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid
SMILESCC(C)CC(CNC(C)CC(C)(C)C)C(=O)O
InChIInChI=1S/C14H29NO2/c1-10(2)7-12(13(16)17)9-15-11(3)8-14(4,5)6/h10-12,15H,7-9H2,1-6H3,(H,16,17)
InChIKeyLBHCAYPXVVRXHH-UHFFFAOYSA-N
MW243.39 g/mol
LogP3.15
Rot. Bonds7

About 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid

2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid (PubChem CID 122128173) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid.

Molecular Properties

Compound Name2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid
PubChem CID122128173
Molecular FormulaC14H29NO2
Molecular Weight243.39 g/mol
Exact Mass243.22
IUPAC Name2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid
SMILESCC(C)CC(CNC(C)CC(C)(C)C)C(=O)O
InChIInChI=1S/C14H29NO2/c1-10(2)7-12(13(16)17)9-15-11(3)8-14(4,5)6/h10-12,15H,7-9H2,1-6H3,(H,16,17)
InChIKeyLBHCAYPXVVRXHH-UHFFFAOYSA-N
XLogP3.15
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.39
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid?
The IUPAC name of 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid (CID 122128173) is 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid.
What is the SMILES notation for 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid?
The canonical SMILES for 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid is CC(C)CC(CNC(C)CC(C)(C)C)C(=O)O.
What is the InChIKey of 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid?
The InChIKey is LBHCAYPXVVRXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-10(2)7-12(13(16)17)9-15-11(3)8-14(4,5)6/h10-12,15H,7-9H2,1-6H3,(H,16,17).
What are the key properties of 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid?
2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid has a molecular weight of 243.39 g/mol, XLogP of 3.15, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-dimethylpentan-2-ylamino)methyl]-4-methylpentanoic acid is sourced from PubChem (CID 122128173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).