C12H25NO2 — CID 122127985
4-methyl-2-[(3-methylbutylamino)methyl]pentanoic acid (PubChem CID 122127985) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-methyl-2-[(3-methylbutylamino)methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[(3-methylbutylamino)methyl]pentanoic acid |
|---|---|
| PubChem CID | 122127985 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 4-methyl-2-[(3-methylbutylamino)methyl]pentanoic acid |
| SMILES | CC(C)CCNCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-9(2)5-6-13-8-11(12(14)15)7-10(3)4/h9-11,13H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | QIIBWRLHEGQGFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|