About 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid
2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid (PubChem CID 122127961) has the molecular formula C17H25Cl2NO2
and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid |
| PubChem CID | 122127961 |
| Molecular Formula | C17H25Cl2NO2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCCCCc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C17H25Cl2NO2/c1-12(2)9-14(17(21)22)11-20-8-4-3-5-13-6-7-15(18)16(19)10-13/h6-7,10,12,14,20H,3-5,8-9,11H2,1-2H3,(H,21,22) |
| InChIKey | JVMRQNOYEYMBQU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid?
The IUPAC name of 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid (CID 122127961) is 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid.
What is the SMILES notation for 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid?
The canonical SMILES for 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid is CC(C)CC(CNCCCCc1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid?
The InChIKey is JVMRQNOYEYMBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25Cl2NO2/c1-12(2)9-14(17(21)22)11-20-8-4-3-5-13-6-7-15(18)16(19)10-13/h6-7,10,12,14,20H,3-5,8-9,11H2,1-2H3,(H,21,22).
What are the key properties of 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid?
2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid has a molecular weight of 346.30 g/mol, XLogP of 4.65, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid is sourced from PubChem (CID 122127961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).