C17H25Cl2NO2 — CID 122127961
2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid (PubChem CID 122127961) has the molecular formula C17H25Cl2NO2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127961 |
| Molecular Formula | C17H25Cl2NO2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)butylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCCCCc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C17H25Cl2NO2/c1-12(2)9-14(17(21)22)11-20-8-4-3-5-13-6-7-15(18)16(19)10-13/h6-7,10,12,14,20H,3-5,8-9,11H2,1-2H3,(H,21,22) |
| InChIKey | JVMRQNOYEYMBQU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|