C15H20F3O2Rh- — CID 163883852
rhodium;1-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)cyclobuten-1-yl]prop-2-en-1-one (PubChem CID 163883852) has the molecular formula C15H20F3O2Rh- and a molecular weight of 392.22 g/mol. Its IUPAC name is rhodium;1-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)cyclobuten-1-yl]prop-2-en-1-one.
| Compound Name | rhodium;1-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)cyclobuten-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163883852 |
| Molecular Formula | C15H20F3O2Rh- |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | rhodium;1-[2-(1,1,1-trifluoro-2-hydroxy-2,5-dimethylhexan-3-yl)cyclobuten-1-yl]prop-2-en-1-one |
| SMILES | C=[C-]C(=O)C1=C(C(CC(C)C)C(C)(O)C(F)(F)F)CC1.[Rh] |
| InChI | InChI=1S/C15H20F3O2.Rh/c1-5-13(19)11-7-6-10(11)12(8-9(2)3)14(4,20)15(16,17)18;/h9,12,20H,1,6-8H2,2-4H3;/q-1; |
| InChIKey | ITXRFKCRUFKDJB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|