C9H18F3NNiO — CID 169074098
3-(diethylamino)-1,1,1-trifluoro-2-methylbutan-2-ol;nickel (PubChem CID 169074098) has the molecular formula C9H18F3NNiO and a molecular weight of 271.94 g/mol. Its IUPAC name is 3-(diethylamino)-1,1,1-trifluoro-2-methylbutan-2-ol;nickel.
| Compound Name | 3-(diethylamino)-1,1,1-trifluoro-2-methylbutan-2-ol;nickel |
|---|---|
| PubChem CID | 169074098 |
| Molecular Formula | C9H18F3NNiO |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-(diethylamino)-1,1,1-trifluoro-2-methylbutan-2-ol;nickel |
| SMILES | CCN(CC)C(C)C(C)(O)C(F)(F)F.[Ni] |
| InChI | InChI=1S/C9H18F3NO.Ni/c1-5-13(6-2)7(3)8(4,14)9(10,11)12;/h7,14H,5-6H2,1-4H3; |
| InChIKey | CXSFSXILMZLQGD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |