C10H21F3N2 — CID 10561221
1-N,1-N,1-N',1-N'-tetraethyl-2,2,2-trifluoroethane-1,1-diamine (PubChem CID 10561221) has the molecular formula C10H21F3N2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetraethyl-2,2,2-trifluoroethane-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetraethyl-2,2,2-trifluoroethane-1,1-diamine |
|---|---|
| PubChem CID | 10561221 |
| Molecular Formula | C10H21F3N2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetraethyl-2,2,2-trifluoroethane-1,1-diamine |
| SMILES | CCN(CC)C(N(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C10H21F3N2/c1-5-14(6-2)9(10(11,12)13)15(7-3)8-4/h9H,5-8H2,1-4H3 |
| InChIKey | BBHZVWNEFRQZTL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|