C16H38N4 — CID 173030058
2-(2,2-diethylhydrazinyl)-1-N,1-N,1-N',1-N'-tetraethyl-2-methylpropane-1,1-diamine (PubChem CID 173030058) has the molecular formula C16H38N4 and a molecular weight of 286.51 g/mol. Its IUPAC name is 2-(2,2-diethylhydrazinyl)-1-N,1-N,1-N',1-N'-tetraethyl-2-methylpropane-1,1-diamine.
| Compound Name | 2-(2,2-diethylhydrazinyl)-1-N,1-N,1-N',1-N'-tetraethyl-2-methylpropane-1,1-diamine |
|---|---|
| PubChem CID | 173030058 |
| Molecular Formula | C16H38N4 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.31 |
| IUPAC Name | 2-(2,2-diethylhydrazinyl)-1-N,1-N,1-N',1-N'-tetraethyl-2-methylpropane-1,1-diamine |
| SMILES | CCN(CC)NC(C)(C)C(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C16H38N4/c1-9-18(10-2)15(19(11-3)12-4)16(7,8)17-20(13-5)14-6/h15,17H,9-14H2,1-8H3 |
| InChIKey | ITVZTPKMNQTEHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|