C40H90N4O6SSi2 — CID 172619358
2-[1,1-bis(diethylamino)-2-methyl-5-triethoxysilylpentan-2-yl]sulfanyl-1-N,1-N,1-N',1-N'-tetraethyl-2-methyl-5-triethoxysilylpentane-1,1-diamine (PubChem CID 172619358) has the molecular formula C40H90N4O6SSi2 and a molecular weight of 811.42 g/mol. Its IUPAC name is 2-[1,1-bis(diethylamino)-2-methyl-5-triethoxysilylpentan-2-yl]sulfanyl-1-N,1-N,1-N',1-N'-tetraethyl-2-methyl-5-triethoxysilylpentane-1,1-diamine.
| Compound Name | 2-[1,1-bis(diethylamino)-2-methyl-5-triethoxysilylpentan-2-yl]sulfanyl-1-N,1-N,1-N',1-N'-tetraethyl-2-methyl-5-triethoxysilylpentane-1,1-diamine |
|---|---|
| PubChem CID | 172619358 |
| Molecular Formula | C40H90N4O6SSi2 |
| Molecular Weight | 811.42 g/mol |
| Exact Mass | 810.61 |
| IUPAC Name | 2-[1,1-bis(diethylamino)-2-methyl-5-triethoxysilylpentan-2-yl]sulfanyl-1-N,1-N,1-N',1-N'-tetraethyl-2-methyl-5-triethoxysilylpentane-1,1-diamine |
| SMILES | CCO[Si](CCCC(C)(SC(C)(CCC[Si](OCC)(OCC)OCC)C(N(CC)CC)N(CC)CC)C(N(CC)CC)N(CC)CC)(OCC)OCC |
| InChI | InChI=1S/C40H90N4O6SSi2/c1-17-41(18-2)37(42(19-3)20-4)39(15,33-31-35-52(45-25-9,46-26-10)47-27-11)51-40(16,38(43(21-5)22-6)44(23-7)24-8)34-32-36-53(48-28-12,49-29-13)50-30-14/h37-38H,17-36H2,1-16H3 |
| InChIKey | JNTIUFILPMSDMH-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.42 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|