C23H48O8S2Si2 — CID 162187678
3,3-bis(3-triethoxysilylpropyl)pentanebis(thioic S-acid) (PubChem CID 162187678) has the molecular formula C23H48O8S2Si2 and a molecular weight of 572.94 g/mol. Its IUPAC name is 3,3-bis(3-triethoxysilylpropyl)pentanebis(thioic S-acid).
| Compound Name | 3,3-bis(3-triethoxysilylpropyl)pentanebis(thioic S-acid) |
|---|---|
| PubChem CID | 162187678 |
| Molecular Formula | C23H48O8S2Si2 |
| Molecular Weight | 572.94 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 3,3-bis(3-triethoxysilylpropyl)pentanebis(thioic S-acid) |
| SMILES | CCO[Si](CCCC(CCC[Si](OCC)(OCC)OCC)(CC(=O)S)CC(=O)S)(OCC)OCC |
| InChI | InChI=1S/C23H48O8S2Si2/c1-7-26-34(27-8-2,28-9-3)17-13-15-23(19-21(24)32,20-22(25)33)16-14-18-35(29-10-4,30-11-5)31-12-6/h7-20H2,1-6H3,(H,24,32)(H,25,33) |
| InChIKey | YLYDFEGPXMZQGS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|