C23H54O12P2Si2 — CID 89468719
[4,4-bis(dimethoxyphosphoryl)-7-triethoxysilylheptyl]-triethoxysilane (PubChem CID 89468719) has the molecular formula C23H54O12P2Si2 and a molecular weight of 640.79 g/mol. Its IUPAC name is [4,4-bis(dimethoxyphosphoryl)-7-triethoxysilylheptyl]-triethoxysilane.
| Compound Name | [4,4-bis(dimethoxyphosphoryl)-7-triethoxysilylheptyl]-triethoxysilane |
|---|---|
| PubChem CID | 89468719 |
| Molecular Formula | C23H54O12P2Si2 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | [4,4-bis(dimethoxyphosphoryl)-7-triethoxysilylheptyl]-triethoxysilane |
| SMILES | CCO[Si](CCCC(CCC[Si](OCC)(OCC)OCC)(P(=O)(OC)OC)P(=O)(OC)OC)(OCC)OCC |
| InChI | InChI=1S/C23H54O12P2Si2/c1-11-30-38(31-12-2,32-13-3)21-17-19-23(36(24,26-7)27-8,37(25,28-9)29-10)20-18-22-39(33-14-4,34-15-5)35-16-6/h11-22H2,1-10H3 |
| InChIKey | GQZYOUXKDOGATD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|