C15H34O6Si — CID 54545002
diethoxy-methoxy-(4,4,4-triethoxybutyl)silane (PubChem CID 54545002) has the molecular formula C15H34O6Si and a molecular weight of 338.52 g/mol. Its IUPAC name is diethoxy-methoxy-(4,4,4-triethoxybutyl)silane.
| Compound Name | diethoxy-methoxy-(4,4,4-triethoxybutyl)silane |
|---|---|
| PubChem CID | 54545002 |
| Molecular Formula | C15H34O6Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | diethoxy-methoxy-(4,4,4-triethoxybutyl)silane |
| SMILES | CCOC(CCC[Si](OC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C15H34O6Si/c1-7-17-15(18-8-2,19-9-3)13-12-14-22(16-6,20-10-4)21-11-5/h7-14H2,1-6H3 |
| InChIKey | ZFXDSDBYUHVRTB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|