C23H54O11Si3 — CID 158589804
[4-(2-ethoxyethoxy)-7-trimethoxysilyl-4-(3-trimethoxysilylpropyl)heptyl]-trimethoxysilane (PubChem CID 158589804) has the molecular formula C23H54O11Si3 and a molecular weight of 590.93 g/mol. Its IUPAC name is [4-(2-ethoxyethoxy)-7-trimethoxysilyl-4-(3-trimethoxysilylpropyl)heptyl]-trimethoxysilane.
| Compound Name | [4-(2-ethoxyethoxy)-7-trimethoxysilyl-4-(3-trimethoxysilylpropyl)heptyl]-trimethoxysilane |
|---|---|
| PubChem CID | 158589804 |
| Molecular Formula | C23H54O11Si3 |
| Molecular Weight | 590.93 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | [4-(2-ethoxyethoxy)-7-trimethoxysilyl-4-(3-trimethoxysilylpropyl)heptyl]-trimethoxysilane |
| SMILES | CCOCCOC(CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C23H54O11Si3/c1-11-33-18-19-34-23(15-12-20-35(24-2,25-3)26-4,16-13-21-36(27-5,28-6)29-7)17-14-22-37(30-8,31-9)32-10/h11-22H2,1-10H3 |
| InChIKey | LQJHAGYLSGDUJH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|