C16H39NO6Si2 — CID 87669047
4-propyl-1,7-bis(trimethoxysilyl)heptan-4-amine (PubChem CID 87669047) has the molecular formula C16H39NO6Si2 and a molecular weight of 397.66 g/mol. Its IUPAC name is 4-propyl-1,7-bis(trimethoxysilyl)heptan-4-amine.
| Compound Name | 4-propyl-1,7-bis(trimethoxysilyl)heptan-4-amine |
|---|---|
| PubChem CID | 87669047 |
| Molecular Formula | C16H39NO6Si2 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-propyl-1,7-bis(trimethoxysilyl)heptan-4-amine |
| SMILES | CCCC(N)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H39NO6Si2/c1-8-11-16(17,12-9-14-24(18-2,19-3)20-4)13-10-15-25(21-5,22-6)23-7/h8-15,17H2,1-7H3 |
| InChIKey | HWVVMVJKXLXYHD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|